About 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate
7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate (PubChem CID 91718434) has the molecular formula C25H48O4
and a molecular weight of 412.66 g/mol. Its IUPAC name is 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate.
Molecular Properties
| Compound Name | 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate |
| PubChem CID | 91718434 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCCC(=O)OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H48O4/c1-5-6-7-8-9-13-20-28-24(26)17-11-10-12-18-25(27)29-21-19-23(4)16-14-15-22(2)3/h22-23H,5-21H2,1-4H3 |
| InChIKey | FEFMSNPPJZIASH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate?
The IUPAC name of 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate (CID 91718434) is 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate.
What is the SMILES notation for 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate?
The canonical SMILES for 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate is CCCCCCCCOC(=O)CCCCCC(=O)OCCC(C)CCCC(C)C.
What is the InChIKey of 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate?
The InChIKey is FEFMSNPPJZIASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48O4/c1-5-6-7-8-9-13-20-28-24(26)17-11-10-12-18-25(27)29-21-19-23(4)16-14-15-22(2)3/h22-23H,5-21H2,1-4H3.
What are the key properties of 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate?
7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate has a molecular weight of 412.66 g/mol, XLogP of 7.24, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-(3,7-dimethyloctyl) 1-O-octyl heptanedioate is sourced from PubChem (CID 91718434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).