C18H19ClN2O2S — CID 9171860
1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-propan-2-ylindole-2,3-dione (PubChem CID 9171860) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-propan-2-ylindole-2,3-dione.
| Compound Name | 1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-propan-2-ylindole-2,3-dione |
|---|---|
| PubChem CID | 9171860 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-propan-2-ylindole-2,3-dione |
| SMILES | CC(C)c1ccc2c(c1)C(=O)C(=O)N2CN(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H19ClN2O2S/c1-11(2)12-4-6-15-14(8-12)17(22)18(23)21(15)10-20(3)9-13-5-7-16(19)24-13/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | KWPKWFMKVNGGGM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|