C19H24BrN3O3 — CID 9171878
N-[(2-bromophenyl)methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methylacetamide (PubChem CID 9171878) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methylacetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 9171878 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methylacetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CN1C(=O)NC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C19H24BrN3O3/c1-22(12-14-8-4-5-9-15(14)20)16(24)13-23-17(25)19(21-18(23)26)10-6-2-3-7-11-19/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H,21,26) |
| InChIKey | XMLLHIWMOPFKFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|