About [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate
[dimethyl(3,3,3-trifluoropropyl)silyl] butanoate (PubChem CID 91718978) has the molecular formula C9H17F3O2Si
and a molecular weight of 242.31 g/mol. Its IUPAC name is [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate.
Molecular Properties
| Compound Name | [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate |
| PubChem CID | 91718978 |
| Molecular Formula | C9H17F3O2Si |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate |
| SMILES | CCCC(=O)O[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C9H17F3O2Si/c1-4-5-8(13)14-15(2,3)7-6-9(10,11)12/h4-7H2,1-3H3 |
| InChIKey | SKNRKYZJVPBETQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate?
The IUPAC name of [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate (CID 91718978) is [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate.
What is the SMILES notation for [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate?
The canonical SMILES for [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate is CCCC(=O)O[Si](C)(C)CCC(F)(F)F.
What is the InChIKey of [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate?
The InChIKey is SKNRKYZJVPBETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3O2Si/c1-4-5-8(13)14-15(2,3)7-6-9(10,11)12/h4-7H2,1-3H3.
What are the key properties of [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate?
[dimethyl(3,3,3-trifluoropropyl)silyl] butanoate has a molecular weight of 242.31 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(3,3,3-trifluoropropyl)silyl] butanoate is sourced from PubChem (CID 91718978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).