C10H9F11 — CID 91718992
7-(difluoromethyl)-1,1,7,8,8,8-hexafluoro-2-(trifluoromethyl)oct-1-ene (PubChem CID 91718992) has the molecular formula C10H9F11 and a molecular weight of 338.16 g/mol. Its IUPAC name is 7-(difluoromethyl)-1,1,7,8,8,8-hexafluoro-2-(trifluoromethyl)oct-1-ene.
| Compound Name | 7-(difluoromethyl)-1,1,7,8,8,8-hexafluoro-2-(trifluoromethyl)oct-1-ene |
|---|---|
| PubChem CID | 91718992 |
| Molecular Formula | C10H9F11 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 7-(difluoromethyl)-1,1,7,8,8,8-hexafluoro-2-(trifluoromethyl)oct-1-ene |
| SMILES | FC(F)=C(CCCCC(F)(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11/c11-6(12)5(9(16,17)18)3-1-2-4-8(15,7(13)14)10(19,20)21/h7H,1-4H2 |
| InChIKey | XUDHUKPJVMIJFO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|