About (1R,3S)-1-chloro-1,3-dimethylsilinane
(1R,3S)-1-chloro-1,3-dimethylsilinane (PubChem CID 91719393) has the molecular formula C7H15ClSi
and a molecular weight of 162.74 g/mol. Its IUPAC name is (1R,3S)-1-chloro-1,3-dimethylsilinane.
Molecular Properties
| Compound Name | (1R,3S)-1-chloro-1,3-dimethylsilinane |
| PubChem CID | 91719393 |
| Molecular Formula | C7H15ClSi |
| Molecular Weight | 162.74 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (1R,3S)-1-chloro-1,3-dimethylsilinane |
| SMILES | C[C@H]1CCC[Si@@](C)(Cl)C1 |
| InChI | InChI=1S/C7H15ClSi/c1-7-4-3-5-9(2,8)6-7/h7H,3-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | OWLSQBYYIRIULL-IONNQARKSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze (1R,3S)-1-chloro-1,3-dimethylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-1-chloro-1,3-dimethylsilinane?
The IUPAC name of (1R,3S)-1-chloro-1,3-dimethylsilinane (CID 91719393) is (1R,3S)-1-chloro-1,3-dimethylsilinane.
What is the SMILES notation for (1R,3S)-1-chloro-1,3-dimethylsilinane?
The canonical SMILES for (1R,3S)-1-chloro-1,3-dimethylsilinane is C[C@H]1CCC[Si@@](C)(Cl)C1.
What is the InChIKey of (1R,3S)-1-chloro-1,3-dimethylsilinane?
The InChIKey is OWLSQBYYIRIULL-IONNQARKSA-N. The full InChI is InChI=1S/C7H15ClSi/c1-7-4-3-5-9(2,8)6-7/h7H,3-6H2,1-2H3/t7-,9+/m0/s1.
What are the key properties of (1R,3S)-1-chloro-1,3-dimethylsilinane?
(1R,3S)-1-chloro-1,3-dimethylsilinane has a molecular weight of 162.74 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-1-chloro-1,3-dimethylsilinane is sourced from PubChem (CID 91719393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).