C7H15ClSi — CID 91719393
(1R,3S)-1-chloro-1,3-dimethylsilinane (PubChem CID 91719393) has the molecular formula C7H15ClSi and a molecular weight of 162.74 g/mol. Its IUPAC name is (1R,3S)-1-chloro-1,3-dimethylsilinane.
| Compound Name | (1R,3S)-1-chloro-1,3-dimethylsilinane |
|---|---|
| PubChem CID | 91719393 |
| Molecular Formula | C7H15ClSi |
| Molecular Weight | 162.74 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (1R,3S)-1-chloro-1,3-dimethylsilinane |
| SMILES | C[C@H]1CCC[Si@@](C)(Cl)C1 |
| InChI | InChI=1S/C7H15ClSi/c1-7-4-3-5-9(2,8)6-7/h7H,3-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | OWLSQBYYIRIULL-IONNQARKSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|