C16H18F5NO3 — CID 91719457
2-methylpropyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate (PubChem CID 91719457) has the molecular formula C16H18F5NO3 and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-methylpropyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate.
| Compound Name | 2-methylpropyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 91719457 |
| Molecular Formula | C16H18F5NO3 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-methylpropyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
| SMILES | CC(C)COC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F5NO3/c1-10(2)9-25-13(23)12(8-11-6-4-3-5-7-11)22-14(24)15(17,18)16(19,20)21/h3-7,10,12H,8-9H2,1-2H3,(H,22,24) |
| InChIKey | OBUMSQYNXSUXLR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|