C21H28F5NO3 — CID 91719458
nonyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate (PubChem CID 91719458) has the molecular formula C21H28F5NO3 and a molecular weight of 437.45 g/mol. Its IUPAC name is nonyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate.
| Compound Name | nonyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 91719458 |
| Molecular Formula | C21H28F5NO3 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | nonyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H28F5NO3/c1-2-3-4-5-6-7-11-14-30-18(28)17(15-16-12-9-8-10-13-16)27-19(29)20(22,23)21(24,25)26/h8-10,12-13,17H,2-7,11,14-15H2,1H3,(H,27,29) |
| InChIKey | SJYNVAKMXGSJME-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|