C22H30F5NO3 — CID 91719459
decyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate (PubChem CID 91719459) has the molecular formula C22H30F5NO3 and a molecular weight of 451.48 g/mol. Its IUPAC name is decyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate.
| Compound Name | decyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 91719459 |
| Molecular Formula | C22H30F5NO3 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | decyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H30F5NO3/c1-2-3-4-5-6-7-8-12-15-31-19(29)18(16-17-13-10-9-11-14-17)28-20(30)21(23,24)22(25,26)27/h9-11,13-14,18H,2-8,12,15-16H2,1H3,(H,28,30) |
| InChIKey | UVEMRDVEVRJYRW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|