C14H16F5NO2 — CID 91719554
2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91719554) has the molecular formula C14H16F5NO2 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91719554 |
| Molecular Formula | C14H16F5NO2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCN(CCOC(=O)C(F)(F)C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C14H16F5NO2/c1-3-20(11-6-4-5-10(2)9-11)7-8-22-12(21)13(15,16)14(17,18)19/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | YPTCRXCWUSFWBX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|