C19H19NO6 — CID 91720637
4-O-[2-(3-nitrophenyl)ethyl] 1-O-propyl benzene-1,4-dicarboxylate (PubChem CID 91720637) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-O-[2-(3-nitrophenyl)ethyl] 1-O-propyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-(3-nitrophenyl)ethyl] 1-O-propyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91720637 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-O-[2-(3-nitrophenyl)ethyl] 1-O-propyl benzene-1,4-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc(C(=O)OCCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-2-11-25-18(21)15-6-8-16(9-7-15)19(22)26-12-10-14-4-3-5-17(13-14)20(23)24/h3-9,13H,2,10-12H2,1H3 |
| InChIKey | SVUDAXGUSNSEAI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|