About N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide
N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9172095) has the molecular formula C20H22N4O3
and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide |
| PubChem CID | 9172095 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2ccccc2NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C20H22N4O3/c1-14-13-15(2)24(23-14)11-6-10-21-19(25)16-7-3-4-8-17(16)22-20(26)18-9-5-12-27-18/h3-5,7-9,12-13H,6,10-11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | RHXFSLIYOYETNY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide?
The IUPAC name of N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide (CID 9172095) is N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide.
What is the SMILES notation for N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide?
The canonical SMILES for N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide is Cc1cc(C)n(CCCNC(=O)c2ccccc2NC(=O)c2ccco2)n1.
What is the InChIKey of N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide?
The InChIKey is RHXFSLIYOYETNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3/c1-14-13-15(2)24(23-14)11-6-10-21-19(25)16-7-3-4-8-17(16)22-20(26)18-9-5-12-27-18/h3-5,7-9,12-13H,6,10-11H2,1-2H3,(H,21,25)(H,22,26).
What are the key properties of N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide?
N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide has a molecular weight of 366.42 g/mol, XLogP of 3.17, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide is sourced from PubChem (CID 9172095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).