C12H7F7O3S — CID 91721061
2,2,3,3,4,4,4-heptafluorobutanoyl 2-methylsulfanylbenzoate (PubChem CID 91721061) has the molecular formula C12H7F7O3S and a molecular weight of 364.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanoyl 2-methylsulfanylbenzoate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 91721061 |
| Molecular Formula | C12H7F7O3S |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F7O3S/c1-23-7-5-3-2-4-6(7)8(20)22-9(21)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3 |
| InChIKey | IMGNOGMIQTVSJA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|