About [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate
[2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate (PubChem CID 91721137) has the molecular formula C16H12F4O2S
and a molecular weight of 344.33 g/mol. Its IUPAC name is [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate |
| PubChem CID | 91721137 |
| Molecular Formula | C16H12F4O2S |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F4O2S/c1-23-11-7-5-10(6-8-11)15(21)22-9-12-13(16(18,19)20)3-2-4-14(12)17/h2-8H,9H2,1H3 |
| InChIKey | CHBKJHAAMVMKLN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate?
The IUPAC name of [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate (CID 91721137) is [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate.
What is the SMILES notation for [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate?
The canonical SMILES for [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate is CSc1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1.
What is the InChIKey of [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate?
The InChIKey is CHBKJHAAMVMKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F4O2S/c1-23-11-7-5-10(6-8-11)15(21)22-9-12-13(16(18,19)20)3-2-4-14(12)17/h2-8H,9H2,1H3.
What are the key properties of [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate?
[2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate has a molecular weight of 344.33 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-methylsulfanylbenzoate is sourced from PubChem (CID 91721137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).