C11H8F11NO5 — CID 91721211
2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxybutanoate (PubChem CID 91721211) has the molecular formula C11H8F11NO5 and a molecular weight of 443.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxybutanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxybutanoate |
|---|---|
| PubChem CID | 91721211 |
| Molecular Formula | C11H8F11NO5 |
| Molecular Weight | 443.17 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxybutanoate |
| SMILES | CC(OC(=O)C(F)(F)F)C(NC(=O)C(F)(F)F)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F11NO5/c1-3(28-7(26)10(17,18)19)4(23-6(25)9(14,15)16)5(24)27-2-8(12,13)11(20,21)22/h3-4H,2H2,1H3,(H,23,25) |
| InChIKey | MCRBGONFYZRMGW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|