C10H10F8N2O4 — CID 91721220
2,2,3,3,3-pentafluoropropyl 5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 91721220) has the molecular formula C10H10F8N2O4 and a molecular weight of 374.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 91721220 |
| Molecular Formula | C10H10F8N2O4 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | NC(=O)CCC(NC(=O)C(F)(F)F)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F8N2O4/c11-8(12,10(16,17)18)3-24-6(22)4(1-2-5(19)21)20-7(23)9(13,14)15/h4H,1-3H2,(H2,19,21)(H,20,23) |
| InChIKey | HHVFRVCGLBJKGR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|