C15H25N — CID 91721266
8-ethyl-5-[(2Z)-penta-2,4-dienyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 91721266) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 8-ethyl-5-[(2Z)-penta-2,4-dienyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 8-ethyl-5-[(2Z)-penta-2,4-dienyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 91721266 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 8-ethyl-5-[(2Z)-penta-2,4-dienyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=C/C=C\CC1CCC(CC)C2CCCN12 |
| InChI | InChI=1S/C15H25N/c1-3-5-6-8-14-11-10-13(4-2)15-9-7-12-16(14)15/h3,5-6,13-15H,1,4,7-12H2,2H3/b6-5- |
| InChIKey | JVEDJXLLDSQAER-WAYWQWQTSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|