C13H10F13NO5 — CID 91721287
bis(2,2,3,3,3-pentafluoropropyl) 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate (PubChem CID 91721287) has the molecular formula C13H10F13NO5 and a molecular weight of 507.20 g/mol. Its IUPAC name is bis(2,2,3,3,3-pentafluoropropyl) 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate.
| Compound Name | bis(2,2,3,3,3-pentafluoropropyl) 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 91721287 |
| Molecular Formula | C13H10F13NO5 |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | bis(2,2,3,3,3-pentafluoropropyl) 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
| SMILES | O=C(CCC(NC(=O)C(F)(F)F)C(=O)OCC(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F13NO5/c14-9(15,12(21,22)23)3-31-6(28)2-1-5(27-8(30)11(18,19)20)7(29)32-4-10(16,17)13(24,25)26/h5H,1-4H2,(H,27,30) |
| InChIKey | RAALFVHWLBEPBO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|