About 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid
2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid (PubChem CID 91721711) has the molecular formula C6H7F3O4
and a molecular weight of 200.11 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid.
Molecular Properties
| Compound Name | 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid |
| PubChem CID | 91721711 |
| Molecular Formula | C6H7F3O4 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid |
| SMILES | CC(C)(OC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H7F3O4/c1-5(2,3(10)11)13-4(12)6(7,8)9/h1-2H3,(H,10,11) |
| InChIKey | KKKNBLWCXHRHFB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid?
The IUPAC name of 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid (CID 91721711) is 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid.
What is the SMILES notation for 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid?
The canonical SMILES for 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid is CC(C)(OC(=O)C(F)(F)F)C(=O)O.
What is the InChIKey of 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid?
The InChIKey is KKKNBLWCXHRHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3O4/c1-5(2,3(10)11)13-4(12)6(7,8)9/h1-2H3,(H,10,11).
What are the key properties of 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid?
2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid has a molecular weight of 200.11 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2,2,2-trifluoroacetyl)oxypropanoic acid is sourced from PubChem (CID 91721711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).