About 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate
2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate (PubChem CID 91722039) has the molecular formula C23H42O4
and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
| PubChem CID | 91722039 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCCC1C(=O)OC(CC)C(C)C |
| InChI | InChI=1S/C23H42O4/c1-5-7-8-9-10-11-14-17-26-22(24)19-15-12-13-16-20(19)23(25)27-21(6-2)18(3)4/h18-21H,5-17H2,1-4H3 |
| InChIKey | LQMSDKIOQPKZRS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate?
The IUPAC name of 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate (CID 91722039) is 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate?
The canonical SMILES for 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate is CCCCCCCCCOC(=O)C1CCCCC1C(=O)OC(CC)C(C)C.
What is the InChIKey of 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate?
The InChIKey is LQMSDKIOQPKZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O4/c1-5-7-8-9-10-11-14-17-26-22(24)19-15-12-13-16-20(19)23(25)27-21(6-2)18(3)4/h18-21H,5-17H2,1-4H3.
What are the key properties of 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate?
2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate has a molecular weight of 382.59 g/mol, XLogP of 6.06, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(2-methylpentan-3-yl) 1-O-nonyl cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 91722039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).