C12H18FOSi — CID 91722313
3-Fluorophenol, diisopropylsilyl ether (PubChem CID 91722313) has the molecular formula C12H18FOSi and a molecular weight of 225.36 g/mol.
| Compound Name | 3-Fluorophenol, diisopropylsilyl ether |
|---|---|
| PubChem CID | 91722313 |
| Molecular Formula | C12H18FOSi |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](Oc1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C12H18FOSi/c1-9(2)15(10(3)4)14-12-7-5-6-11(13)8-12/h5-10H,1-4H3 |
| InChIKey | WMIMGOANDDLLKD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|