C16H10F8O2 — CID 91722389
2,2,3,3,4,4,5,5-octafluoropentyl naphthalene-1-carboxylate (PubChem CID 91722389) has the molecular formula C16H10F8O2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl naphthalene-1-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 91722389 |
| Molecular Formula | C16H10F8O2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl naphthalene-1-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H10F8O2/c17-13(18)15(21,22)16(23,24)14(19,20)8-26-12(25)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,13H,8H2 |
| InChIKey | LFTALLNVWKRZAG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|