C17H28N2O5 — CID 91722432
but-3-enyl 2-[2-[but-3-enoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate (PubChem CID 91722432) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is but-3-enyl 2-[2-[but-3-enoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate.
| Compound Name | but-3-enyl 2-[2-[but-3-enoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 91722432 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | but-3-enyl 2-[2-[but-3-enoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate |
| SMILES | C=CCCOC(=O)C(C)N(C)C(=O)C(C)N(C)C(=O)OCCC=C |
| InChI | InChI=1S/C17H28N2O5/c1-7-9-11-23-16(21)14(4)18(5)15(20)13(3)19(6)17(22)24-12-10-8-2/h7-8,13-14H,1-2,9-12H2,3-6H3 |
| InChIKey | AYVPQDQUTYNVPN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|