C28H46O5Si — CID 91723326
[3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 91723326) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91723326 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O[Si](C)(C)C)CC(=O)O3)C21 |
| InChI | InChI=1S/C28H46O5Si/c1-9-28(4,5)27(30)32-24-15-18(2)14-20-11-10-19(3)23(26(20)24)13-12-21-16-22(17-25(29)31-21)33-34(6,7)8/h10-11,14,18-19,21-24,26H,9,12-13,15-17H2,1-8H3 |
| InChIKey | SUEDSISDIUMYSI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|