About 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene
1-(butan-2-yloxymethyl)-2,3-dichlorobenzene (PubChem CID 91723376) has the molecular formula C11H14Cl2O
and a molecular weight of 233.14 g/mol. Its IUPAC name is 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene |
| PubChem CID | 91723376 |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene |
| SMILES | CCC(C)OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2O/c1-3-8(2)14-7-9-5-4-6-10(12)11(9)13/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | NLSURMQCIQWYBX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene?
The IUPAC name of 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene (CID 91723376) is 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene.
What is the SMILES notation for 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene?
The canonical SMILES for 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene is CCC(C)OCc1cccc(Cl)c1Cl.
What is the InChIKey of 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene?
The InChIKey is NLSURMQCIQWYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2O/c1-3-8(2)14-7-9-5-4-6-10(12)11(9)13/h4-6,8H,3,7H2,1-2H3.
What are the key properties of 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene?
1-(butan-2-yloxymethyl)-2,3-dichlorobenzene has a molecular weight of 233.14 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(butan-2-yloxymethyl)-2,3-dichlorobenzene is sourced from PubChem (CID 91723376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).