C16H32S4 — CID 91723910
(E)-1,1,4,4-tetrakis(propylsulfanyl)but-2-ene (PubChem CID 91723910) has the molecular formula C16H32S4 and a molecular weight of 352.70 g/mol. Its IUPAC name is (E)-1,1,4,4-tetrakis(propylsulfanyl)but-2-ene.
| Compound Name | (E)-1,1,4,4-tetrakis(propylsulfanyl)but-2-ene |
|---|---|
| PubChem CID | 91723910 |
| Molecular Formula | C16H32S4 |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-1,1,4,4-tetrakis(propylsulfanyl)but-2-ene |
| SMILES | CCCSC(/C=C/C(SCCC)SCCC)SCCC |
| InChI | InChI=1S/C16H32S4/c1-5-11-17-15(18-12-6-2)9-10-16(19-13-7-3)20-14-8-4/h9-10,15-16H,5-8,11-14H2,1-4H3/b10-9+ |
| InChIKey | VVLCCRJXCRFJNO-MDZDMXLPSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|