C19H16F4O4 — CID 91723986
1-O-butyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91723986) has the molecular formula C19H16F4O4 and a molecular weight of 384.33 g/mol. Its IUPAC name is 1-O-butyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-butyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91723986 |
| Molecular Formula | C19H16F4O4 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-O-butyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H16F4O4/c1-2-3-8-26-18(24)12-6-4-5-7-13(12)19(25)27-10-11-9-14(20)16(22)17(23)15(11)21/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | LCDDYAZXEHNOKU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|