C20H18F4O4 — CID 91723987
1-O-pentyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91723987) has the molecular formula C20H18F4O4 and a molecular weight of 398.35 g/mol. Its IUPAC name is 1-O-pentyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-pentyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91723987 |
| Molecular Formula | C20H18F4O4 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-O-pentyl 2-O-[(2,3,4,5-tetrafluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)OCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18F4O4/c1-2-3-6-9-27-19(25)13-7-4-5-8-14(13)20(26)28-11-12-10-15(21)17(23)18(24)16(12)22/h4-5,7-8,10H,2-3,6,9,11H2,1H3 |
| InChIKey | XRBULHLKHFVCRE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|