About heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate
heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 91724236) has the molecular formula C14H22F3NO3
and a molecular weight of 309.33 g/mol. Its IUPAC name is heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
Molecular Properties
| Compound Name | heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| PubChem CID | 91724236 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)F)C(=O)OCCCCCCC |
| InChI | InChI=1S/C14H22F3NO3/c1-3-5-6-7-8-10-21-12(19)11(9-4-2)18-13(20)14(15,16)17/h4,11H,2-3,5-10H2,1H3,(H,18,20) |
| InChIKey | FKKQRBOEJSHRAT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The IUPAC name of heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (CID 91724236) is heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
What is the SMILES notation for heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The canonical SMILES for heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate is C=CCC(NC(=O)C(F)(F)F)C(=O)OCCCCCCC.
What is the InChIKey of heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The InChIKey is FKKQRBOEJSHRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F3NO3/c1-3-5-6-7-8-10-21-12(19)11(9-4-2)18-13(20)14(15,16)17/h4,11H,2-3,5-10H2,1H3,(H,18,20).
What are the key properties of heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate has a molecular weight of 309.33 g/mol, XLogP of 3.12, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate is sourced from PubChem (CID 91724236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).