C18H31NO2 — CID 91724242
(6Z)-6-[(E)-6-hydroxy-2,5-dimethylhept-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 91724242) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (6Z)-6-[(E)-6-hydroxy-2,5-dimethylhept-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z)-6-[(E)-6-hydroxy-2,5-dimethylhept-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 91724242 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (6Z)-6-[(E)-6-hydroxy-2,5-dimethylhept-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | C/C(=C\CC(C)/C=C1\CN2CCCC2C(C)(O)C1)C(C)O |
| InChI | InChI=1S/C18H31NO2/c1-13(7-8-14(2)15(3)20)10-16-11-18(4,21)17-6-5-9-19(17)12-16/h8,10,13,15,17,20-21H,5-7,9,11-12H2,1-4H3/b14-8+,16-10- |
| InChIKey | DOZWSDZZUHZNRZ-DGSKHJRPSA-N |
| XLogP | 2.89 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|