About 3-acetyl-1,6-dimethylpyridine-2,4-dione
3-acetyl-1,6-dimethylpyridine-2,4-dione (PubChem CID 91724370) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-acetyl-1,6-dimethylpyridine-2,4-dione.
Molecular Properties
| Compound Name | 3-acetyl-1,6-dimethylpyridine-2,4-dione |
| PubChem CID | 91724370 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-acetyl-1,6-dimethylpyridine-2,4-dione |
| SMILES | CC(=O)C1C(=O)C=C(C)N(C)C1=O |
| InChI | InChI=1S/C9H11NO3/c1-5-4-7(12)8(6(2)11)9(13)10(5)3/h4,8H,1-3H3 |
| InChIKey | ZCNHVSLWGGPSJN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-1,6-dimethylpyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1,6-dimethylpyridine-2,4-dione?
The IUPAC name of 3-acetyl-1,6-dimethylpyridine-2,4-dione (CID 91724370) is 3-acetyl-1,6-dimethylpyridine-2,4-dione.
What is the SMILES notation for 3-acetyl-1,6-dimethylpyridine-2,4-dione?
The canonical SMILES for 3-acetyl-1,6-dimethylpyridine-2,4-dione is CC(=O)C1C(=O)C=C(C)N(C)C1=O.
What is the InChIKey of 3-acetyl-1,6-dimethylpyridine-2,4-dione?
The InChIKey is ZCNHVSLWGGPSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-5-4-7(12)8(6(2)11)9(13)10(5)3/h4,8H,1-3H3.
What are the key properties of 3-acetyl-1,6-dimethylpyridine-2,4-dione?
3-acetyl-1,6-dimethylpyridine-2,4-dione has a molecular weight of 181.19 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1,6-dimethylpyridine-2,4-dione is sourced from PubChem (CID 91724370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).