C16H14F2O2S — CID 91724923
1-(2,6-difluorophenyl)ethyl 4-methylsulfanylbenzoate (PubChem CID 91724923) has the molecular formula C16H14F2O2S and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)ethyl 4-methylsulfanylbenzoate.
| Compound Name | 1-(2,6-difluorophenyl)ethyl 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 91724923 |
| Molecular Formula | C16H14F2O2S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-(2,6-difluorophenyl)ethyl 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)OC(C)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H14F2O2S/c1-10(15-13(17)4-3-5-14(15)18)20-16(19)11-6-8-12(21-2)9-7-11/h3-10H,1-2H3 |
| InChIKey | NJXVPUSXNDCSHK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |