About prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate
prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate (PubChem CID 91725591) has the molecular formula C19H32N2O5
and a molecular weight of 368.47 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate.
Molecular Properties
| Compound Name | prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate |
| PubChem CID | 91725591 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate |
| SMILES | C=CCOC(=O)NC(CCCC)C(=O)NC(CCCC)C(=O)OCC=C |
| InChI | InChI=1S/C19H32N2O5/c1-5-9-11-15(21-19(24)26-14-8-4)17(22)20-16(12-10-6-2)18(23)25-13-7-3/h7-8,15-16H,3-6,9-14H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | DZKUWXBDQUWBAY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate?
The IUPAC name of prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate (CID 91725591) is prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate.
What is the SMILES notation for prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate?
The canonical SMILES for prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate is C=CCOC(=O)NC(CCCC)C(=O)NC(CCCC)C(=O)OCC=C.
What is the InChIKey of prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate?
The InChIKey is DZKUWXBDQUWBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O5/c1-5-9-11-15(21-19(24)26-14-8-4)17(22)20-16(12-10-6-2)18(23)25-13-7-3/h7-8,15-16H,3-6,9-14H2,1-2H3,(H,20,22)(H,21,24).
What are the key properties of prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate?
prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate has a molecular weight of 368.47 g/mol, XLogP of 2.86, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)hexanoylamino]hexanoate is sourced from PubChem (CID 91725591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).