C20H42O3Si2 — CID 91726528
ethenyl-(ethenyl-heptan-4-yloxy-methylsilyl)oxy-heptan-4-yloxy-methylsilane (PubChem CID 91726528) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is ethenyl-(ethenyl-heptan-4-yloxy-methylsilyl)oxy-heptan-4-yloxy-methylsilane.
| Compound Name | ethenyl-(ethenyl-heptan-4-yloxy-methylsilyl)oxy-heptan-4-yloxy-methylsilane |
|---|---|
| PubChem CID | 91726528 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | ethenyl-(ethenyl-heptan-4-yloxy-methylsilyl)oxy-heptan-4-yloxy-methylsilane |
| SMILES | C=C[Si](C)(OC(CCC)CCC)O[Si](C)(C=C)OC(CCC)CCC |
| InChI | InChI=1S/C20H42O3Si2/c1-9-15-19(16-10-2)21-24(7,13-5)23-25(8,14-6)22-20(17-11-3)18-12-4/h13-14,19-20H,5-6,9-12,15-18H2,1-4,7-8H3 |
| InChIKey | GSSNCNXEVGZZOG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|