C9H7F10NO3 — CID 91726860
3-(2,2,3,3,3-pentafluoropropanoylamino)propyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91726860) has the molecular formula C9H7F10NO3 and a molecular weight of 367.14 g/mol. Its IUPAC name is 3-(2,2,3,3,3-pentafluoropropanoylamino)propyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 3-(2,2,3,3,3-pentafluoropropanoylamino)propyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91726860 |
| Molecular Formula | C9H7F10NO3 |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-(2,2,3,3,3-pentafluoropropanoylamino)propyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCCCOC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F10NO3/c10-6(11,8(14,15)16)4(21)20-2-1-3-23-5(22)7(12,13)9(17,18)19/h1-3H2,(H,20,21) |
| InChIKey | MZRZYRSHHYXUFP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|