C12H13F10NO3 — CID 91726879
6-(2,2,3,3,3-pentafluoropropanoylamino)hexyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91726879) has the molecular formula C12H13F10NO3 and a molecular weight of 409.22 g/mol. Its IUPAC name is 6-(2,2,3,3,3-pentafluoropropanoylamino)hexyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 6-(2,2,3,3,3-pentafluoropropanoylamino)hexyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91726879 |
| Molecular Formula | C12H13F10NO3 |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 6-(2,2,3,3,3-pentafluoropropanoylamino)hexyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCCCCCCOC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F10NO3/c13-9(14,11(17,18)19)7(24)23-5-3-1-2-4-6-26-8(25)10(15,16)12(20,21)22/h1-6H2,(H,23,24) |
| InChIKey | MVMRMDCCFHBSKH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|