C11H18F5NO — CID 91726924
N-(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91726924) has the molecular formula C11H18F5NO and a molecular weight of 275.26 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91726924 |
| Molecular Formula | C11H18F5NO |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCCCC(CC)CNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H18F5NO/c1-3-5-6-8(4-2)7-17-9(18)10(12,13)11(14,15)16/h8H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | QODLOCKHLXCIMQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|