C8H12F5NO — CID 91727024
2,2,3,3,3-pentafluoro-N-(3-methylbutyl)propanamide (PubChem CID 91727024) has the molecular formula C8H12F5NO and a molecular weight of 233.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(3-methylbutyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 91727024 |
| Molecular Formula | C8H12F5NO |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F5NO/c1-5(2)3-4-14-6(15)7(9,10)8(11,12)13/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | UHCIHGOYCUACPW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|