About 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate
3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate (PubChem CID 91727216) has the molecular formula C11H19Cl2NO4
and a molecular weight of 300.18 g/mol. Its IUPAC name is 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate.
Molecular Properties
| Compound Name | 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate |
| PubChem CID | 91727216 |
| Molecular Formula | C11H19Cl2NO4 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate |
| SMILES | CC(C(=O)OCCCCl)N(C)C(=O)OCCCCl |
| InChI | InChI=1S/C11H19Cl2NO4/c1-9(10(15)17-7-3-5-12)14(2)11(16)18-8-4-6-13/h9H,3-8H2,1-2H3 |
| InChIKey | SJXUQVYCJBCXSB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate?
The IUPAC name of 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate (CID 91727216) is 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate.
What is the SMILES notation for 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate?
The canonical SMILES for 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate is CC(C(=O)OCCCCl)N(C)C(=O)OCCCCl.
What is the InChIKey of 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate?
The InChIKey is SJXUQVYCJBCXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19Cl2NO4/c1-9(10(15)17-7-3-5-12)14(2)11(16)18-8-4-6-13/h9H,3-8H2,1-2H3.
What are the key properties of 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate?
3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate has a molecular weight of 300.18 g/mol, XLogP of 2.24, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl 2-[3-chloropropoxycarbonyl(methyl)amino]propanoate is sourced from PubChem (CID 91727216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).