C19H31NO4 — CID 91727342
octyl 1-(but-2-ynoxycarbonylamino)cyclopentane-1-carboxylate (PubChem CID 91727342) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is octyl 1-(but-2-ynoxycarbonylamino)cyclopentane-1-carboxylate.
| Compound Name | octyl 1-(but-2-ynoxycarbonylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 91727342 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | octyl 1-(but-2-ynoxycarbonylamino)cyclopentane-1-carboxylate |
| SMILES | CC#CCOC(=O)NC1(C(=O)OCCCCCCCC)CCCC1 |
| InChI | InChI=1S/C19H31NO4/c1-3-5-7-8-9-12-16-23-17(21)19(13-10-11-14-19)20-18(22)24-15-6-4-2/h3,5,7-16H2,1-2H3,(H,20,22) |
| InChIKey | IOIGYYGYLAWUNB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|