C20H35NO2 — CID 91727358
(3Z)-3-[(E)-6-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol (PubChem CID 91727358) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (3Z)-3-[(E)-6-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol.
| Compound Name | (3Z)-3-[(E)-6-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
|---|---|
| PubChem CID | 91727358 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (3Z)-3-[(E)-6-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
| SMILES | CCC(O)/C(C)=C/CC(C)/C=C1\CN2CCCCC2C(C)(O)C1 |
| InChI | InChI=1S/C20H35NO2/c1-5-18(22)16(3)10-9-15(2)12-17-13-20(4,23)19-8-6-7-11-21(19)14-17/h10,12,15,18-19,22-23H,5-9,11,13-14H2,1-4H3/b16-10+,17-12- |
| InChIKey | XVLHKGZQPMLRAB-BSTPEVQJSA-N |
| XLogP | 3.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|