C21H37NO2 — CID 91727360
(3Z)-3-[(E)-6-hydroxy-2,5-dimethylnon-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol (PubChem CID 91727360) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is (3Z)-3-[(E)-6-hydroxy-2,5-dimethylnon-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol.
| Compound Name | (3Z)-3-[(E)-6-hydroxy-2,5-dimethylnon-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
|---|---|
| PubChem CID | 91727360 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | (3Z)-3-[(E)-6-hydroxy-2,5-dimethylnon-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
| SMILES | CCCC(O)/C(C)=C/CC(C)/C=C1\CN2CCCCC2C(C)(O)C1 |
| InChI | InChI=1S/C21H37NO2/c1-5-8-19(23)17(3)11-10-16(2)13-18-14-21(4,24)20-9-6-7-12-22(20)15-18/h11,13,16,19-20,23-24H,5-10,12,14-15H2,1-4H3/b17-11+,18-13- |
| InChIKey | JGBBWGDENDYKDS-JAFZKPNWSA-N |
| XLogP | 4.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|