C19H11F7N2O3 — CID 91727424
3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 91727424) has the molecular formula C19H11F7N2O3 and a molecular weight of 448.29 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91727424 |
| Molecular Formula | C19H11F7N2O3 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H11F7N2O3/c20-17(21,18(22,23)19(24,25)26)14(30)28-13(29)16(27-15(28)31,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,27,31) |
| InChIKey | STKHQLZUUJTGBP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|