C14H10F5NO3 — CID 91727502
(2,3,4,5,6-pentafluorophenyl)methyl (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (PubChem CID 91727502) has the molecular formula C14H10F5NO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
|---|---|
| PubChem CID | 91727502 |
| Molecular Formula | C14H10F5NO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| SMILES | C=CCNC(=O)/C=C/C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H10F5NO3/c1-2-5-20-8(21)3-4-9(22)23-6-7-10(15)12(17)14(19)13(18)11(7)16/h2-4H,1,5-6H2,(H,20,21)/b4-3+ |
| InChIKey | RBYLQSLCYFPNTO-ONEGZZNKSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|