C9HF9O3 — CID 91727548
(2,3,5,6-tetrafluoro-4-hydroxyphenyl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91727548) has the molecular formula C9HF9O3 and a molecular weight of 328.09 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-hydroxyphenyl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (2,3,5,6-tetrafluoro-4-hydroxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91727548 |
| Molecular Formula | C9HF9O3 |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-hydroxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(Oc1c(F)c(F)c(O)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF9O3/c10-1-3(12)6(4(13)2(11)5(1)19)21-7(20)8(14,15)9(16,17)18/h19H |
| InChIKey | HLECOYUZBRJIHT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|