C20H17F7O2 — CID 91727603
2,2,3,3,4,4,4-heptafluorobutyl 2-(1,2,3,4-tetrahydrophenanthren-4-yl)acetate (PubChem CID 91727603) has the molecular formula C20H17F7O2 and a molecular weight of 422.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-(1,2,3,4-tetrahydrophenanthren-4-yl)acetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-(1,2,3,4-tetrahydrophenanthren-4-yl)acetate |
|---|---|
| PubChem CID | 91727603 |
| Molecular Formula | C20H17F7O2 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-(1,2,3,4-tetrahydrophenanthren-4-yl)acetate |
| SMILES | O=C(CC1CCCc2ccc3ccccc3c21)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H17F7O2/c21-18(22,19(23,24)20(25,26)27)11-29-16(28)10-14-6-3-5-13-9-8-12-4-1-2-7-15(12)17(13)14/h1-2,4,7-9,14H,3,5-6,10-11H2 |
| InChIKey | CBEPRIWEJAXZSU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|