C12H20F3NO3 — CID 91727813
butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 91727813) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 91727813 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CCCCOC(=O)[C@@H](NC(=O)C(F)(F)F)[C@@H](C)CC |
| InChI | InChI=1S/C12H20F3NO3/c1-4-6-7-19-10(17)9(8(3)5-2)16-11(18)12(13,14)15/h8-9H,4-7H2,1-3H3,(H,16,18)/t8-,9-/m0/s1 |
| InChIKey | RXCCQFOMEQOSMR-IUCAKERBSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|