C15H29NO — CID 91727969
3-butyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 91727969) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 3-butyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | 3-butyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 91727969 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 3-butyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | CCCCC1CCC2C(O)CCC(CCC)N12 |
| InChI | InChI=1S/C15H29NO/c1-3-5-7-13-8-10-14-15(17)11-9-12(6-4-2)16(13)14/h12-15,17H,3-11H2,1-2H3 |
| InChIKey | OWUDYXYKBKVMPE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |