About 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate
3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate (PubChem CID 91728144) has the molecular formula C8H12Cl2O4
and a molecular weight of 243.09 g/mol. Its IUPAC name is 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate.
Molecular Properties
| Compound Name | 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate |
| PubChem CID | 91728144 |
| Molecular Formula | C8H12Cl2O4 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate |
| SMILES | CCCOC(=O)CC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C8H12Cl2O4/c1-2-3-13-7(11)4-8(12)14-5-6(9)10/h6H,2-5H2,1H3 |
| InChIKey | OSKMQXOYMHLDJW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate?
The IUPAC name of 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate (CID 91728144) is 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate.
What is the SMILES notation for 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate?
The canonical SMILES for 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate is CCCOC(=O)CC(=O)OCC(Cl)Cl.
What is the InChIKey of 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate?
The InChIKey is OSKMQXOYMHLDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Cl2O4/c1-2-3-13-7(11)4-8(12)14-5-6(9)10/h6H,2-5H2,1H3.
What are the key properties of 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate?
3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate has a molecular weight of 243.09 g/mol, XLogP of 1.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(2,2-dichloroethyl) 1-O-propyl propanedioate is sourced from PubChem (CID 91728144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).