C11H6BrF7O2 — CID 91728331
2,2,3,3,4,4,4-heptafluorobutyl 4-bromobenzoate (PubChem CID 91728331) has the molecular formula C11H6BrF7O2 and a molecular weight of 383.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 4-bromobenzoate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 4-bromobenzoate |
|---|---|
| PubChem CID | 91728331 |
| Molecular Formula | C11H6BrF7O2 |
| Molecular Weight | 383.06 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 4-bromobenzoate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H6BrF7O2/c12-7-3-1-6(2-4-7)8(20)21-5-9(13,14)10(15,16)11(17,18)19/h1-4H,5H2 |
| InChIKey | HHBYLNANMUIAQB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.06 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|